C17H24F2N4O — CID 136760818
cyclopropyl-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136760818) has the molecular formula C17H24F2N4O and a molecular weight of 338.40 g/mol. Its IUPAC name is cyclopropyl-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136760818 |
| Molecular Formula | C17H24F2N4O |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | cyclopropyl-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCCN(C(=O)C3CC3)C1)N2 |
| InChI | InChI=1S/C17H24F2N4O/c1-10-7-15-20-13(8-14(16(18)19)23(15)21-10)12-3-2-6-22(9-12)17(24)11-4-5-11/h7,11-14,16,20H,2-6,8-9H2,1H3/t12?,13-,14+/m0/s1 |
| InChIKey | LZYZHIDAFVSGRC-KFTPUPIBSA-N |
| XLogP | 2.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |