C20H26F2N4OS — CID 136760861
[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4,5-dimethylthiophen-2-yl)methanone (PubChem CID 136760861) has the molecular formula C20H26F2N4OS and a molecular weight of 408.52 g/mol. Its IUPAC name is [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4,5-dimethylthiophen-2-yl)methanone.
| Compound Name | [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4,5-dimethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 136760861 |
| Molecular Formula | C20H26F2N4OS |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4,5-dimethylthiophen-2-yl)methanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCCN(C(=O)c3cc(C)c(C)s3)C1)N2 |
| InChI | InChI=1S/C20H26F2N4OS/c1-11-7-17(28-13(11)3)20(27)25-6-4-5-14(10-25)15-9-16(19(21)22)26-18(23-15)8-12(2)24-26/h7-8,14-16,19,23H,4-6,9-10H2,1-3H3/t14?,15-,16+/m0/s1 |
| InChIKey | NQSJQMMQRUVIBS-MERJSTESSA-N |
| XLogP | 4.41 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |