C22H28F2N4O2 — CID 136760827
1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 136760827) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 136760827 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCCC([C@@H]3C[C@H](C(F)F)n4nc(C)cc4N3)C2)cc1 |
| InChI | InChI=1S/C22H28F2N4O2/c1-14-10-20-25-18(12-19(22(23)24)28(20)26-14)16-4-3-9-27(13-16)21(29)11-15-5-7-17(30-2)8-6-15/h5-8,10,16,18-19,22,25H,3-4,9,11-13H2,1-2H3/t16?,18-,19+/m0/s1 |
| InChIKey | QXEUKGQDSSKJSR-NGFYBIIMSA-N |
| XLogP | 3.67 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |