C23H30F2N4O3 — CID 136860737
1-[(3S)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone (PubChem CID 136860737) has the molecular formula C23H30F2N4O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is 1-[(3S)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone.
| Compound Name | 1-[(3S)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 136860737 |
| Molecular Formula | C23H30F2N4O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[(3S)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
| SMILES | COc1cc(C)ccc1OCC(=O)N1CCC[C@H]([C@@H]2C[C@H](C(F)F)n3nc(C)cc3N2)C1 |
| InChI | InChI=1S/C23H30F2N4O3/c1-14-6-7-19(20(9-14)31-3)32-13-22(30)28-8-4-5-16(12-28)17-11-18(23(24)25)29-21(26-17)10-15(2)27-29/h6-7,9-10,16-18,23,26H,4-5,8,11-13H2,1-3H3/t16-,17-,18+/m0/s1 |
| InChIKey | QBUVHFLYSIPQGM-OKZBNKHCSA-N |
| XLogP | 3.82 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |