C24H30F2N4O2 — CID 136760667
[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone (PubChem CID 136760667) has the molecular formula C24H30F2N4O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is [4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone.
| Compound Name | [4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone |
|---|---|
| PubChem CID | 136760667 |
| Molecular Formula | C24H30F2N4O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone |
| SMILES | C=CCc1cc(C(=O)N2CCC([C@@H]3C[C@H](C(F)F)n4nc(C)cc4N3)CC2)ccc1OC |
| InChI | InChI=1S/C24H30F2N4O2/c1-4-5-17-13-18(6-7-21(17)32-3)24(31)29-10-8-16(9-11-29)19-14-20(23(25)26)30-22(27-19)12-15(2)28-30/h4,6-7,12-13,16,19-20,23,27H,1,5,8-11,14H2,2-3H3/t19-,20+/m0/s1 |
| InChIKey | PAFUETJXPQTGQY-VQTJNVASSA-N |
| XLogP | 4.47 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|