C20H27NO4 — CID 97142111
[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone (PubChem CID 97142111) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone.
| Compound Name | [(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone |
|---|---|
| PubChem CID | 97142111 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methoxy-3-prop-2-enylphenyl)methanone |
| SMILES | C=CCc1cc(C(=O)N2CCC3(CC2)OCCC[C@H]3O)ccc1OC |
| InChI | InChI=1S/C20H27NO4/c1-3-5-15-14-16(7-8-17(15)24-2)19(23)21-11-9-20(10-12-21)18(22)6-4-13-25-20/h3,7-8,14,18,22H,1,4-6,9-13H2,2H3/t18-/m1/s1 |
| InChIKey | NTKFGUIFWXUQMQ-GOSISDBHSA-N |
| XLogP | 2.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|