C17H23NO5S — CID 97120046
[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 97120046) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is [(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 97120046 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC3(CC2)OCCC[C@@H]3O)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-24(21,22)14-6-4-13(5-7-14)16(20)18-10-8-17(9-11-18)15(19)3-2-12-23-17/h4-7,15,19H,2-3,8-12H2,1H3/t15-/m0/s1 |
| InChIKey | KJGPZKUCIOPTHK-HNNXBMFYSA-N |
| XLogP | 1.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |