C21H24F4N4O — CID 136760670
1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone (PubChem CID 136760670) has the molecular formula C21H24F4N4O and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone.
| Compound Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 136760670 |
| Molecular Formula | C21H24F4N4O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCN(C(=O)Cc3cc(F)ccc3F)CC1)N2 |
| InChI | InChI=1S/C21H24F4N4O/c1-12-8-19-26-17(11-18(21(24)25)29(19)27-12)13-4-6-28(7-5-13)20(30)10-14-9-15(22)2-3-16(14)23/h2-3,8-9,13,17-18,21,26H,4-7,10-11H2,1H3/t17-,18+/m0/s1 |
| InChIKey | ATOQVXZKDXJSCH-ZWKOTPCHSA-N |
| XLogP | 3.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |