C22H35F2N5O — CID 136892172
1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(2R)-2-ethylpiperidin-1-yl]ethanone (PubChem CID 136892172) has the molecular formula C22H35F2N5O and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(2R)-2-ethylpiperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(2R)-2-ethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 136892172 |
| Molecular Formula | C22H35F2N5O |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(2R)-2-ethylpiperidin-1-yl]ethanone |
| SMILES | CC[C@@H]1CCCCN1CC(=O)N1CCC([C@@H]2C[C@H](C(F)F)n3nc(C)cc3N2)CC1 |
| InChI | InChI=1S/C22H35F2N5O/c1-3-17-6-4-5-9-28(17)14-21(30)27-10-7-16(8-11-27)18-13-19(22(23)24)29-20(25-18)12-15(2)26-29/h12,16-19,22,25H,3-11,13-14H2,1-2H3/t17-,18+,19-/m1/s1 |
| InChIKey | QNIDJLJFXFDYKC-CEXWTWQISA-N |
| XLogP | 3.69 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |