C23H30F2N4O2 — CID 136760831
1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone (PubChem CID 136760831) has the molecular formula C23H30F2N4O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 136760831 |
| Molecular Formula | C23H30F2N4O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCCC([C@@H]3C[C@H](C(F)F)n4nc(C)cc4N3)C2)cc1 |
| InChI | InChI=1S/C23H30F2N4O2/c1-3-31-18-8-6-16(7-9-18)12-22(30)28-10-4-5-17(14-28)19-13-20(23(24)25)29-21(26-19)11-15(2)27-29/h6-9,11,17,19-20,23,26H,3-5,10,12-14H2,1-2H3/t17?,19-,20+/m0/s1 |
| InChIKey | HJUCVODREKROPM-ZYJPSCNZSA-N |
| XLogP | 4.06 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |