C21H32F2N4O3 — CID 136860620
1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone (PubChem CID 136860620) has the molecular formula C21H32F2N4O3 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone.
| Compound Name | 1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 136860620 |
| Molecular Formula | C21H32F2N4O3 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H]([C@@H]1CCCN(C(=O)COC[C@@H]3CCCCO3)C1)N2 |
| InChI | InChI=1S/C21H32F2N4O3/c1-14-9-19-24-17(10-18(21(22)23)27(19)25-14)15-5-4-7-26(11-15)20(28)13-29-12-16-6-2-3-8-30-16/h9,15-18,21,24H,2-8,10-13H2,1H3/t15-,16+,17+,18-/m1/s1 |
| InChIKey | NSWZKTCLGQYWLQ-VSZNYVQBSA-N |
| XLogP | 3.01 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |