C19H29F2N5O3 — CID 136821170
1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2R)-oxan-2-yl]methoxy]ethanone (PubChem CID 136821170) has the molecular formula C19H29F2N5O3 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2R)-oxan-2-yl]methoxy]ethanone.
| Compound Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2R)-oxan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 136821170 |
| Molecular Formula | C19H29F2N5O3 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[4-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[[(2R)-oxan-2-yl]methoxy]ethanone |
| SMILES | O=C(COC[C@H]1CCCCO1)N1CCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)CC1 |
| InChI | InChI=1S/C19H29F2N5O3/c20-18(21)16-9-15(24-19-22-12-23-26(16)19)13-4-6-25(7-5-13)17(27)11-28-10-14-3-1-2-8-29-14/h12-16,18H,1-11H2,(H,22,23,24)/t14-,15+,16-/m1/s1 |
| InChIKey | BXZDAPDOTCPEIA-OWCLPIDISA-N |
| XLogP | 2.09 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |