C21H27F2N5O3 — CID 136886441
[(3S)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone (PubChem CID 136886441) has the molecular formula C21H27F2N5O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is [(3S)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | [(3S)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 136886441 |
| Molecular Formula | C21H27F2N5O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | [(3S)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCC[C@H]([C@@H]3C[C@H](C(F)F)n4ncnc4N3)C2)cc1 |
| InChI | InChI=1S/C21H27F2N5O3/c1-30-9-10-31-16-6-4-14(5-7-16)20(29)27-8-2-3-15(12-27)17-11-18(19(22)23)28-21(26-17)24-13-25-28/h4-7,13,15,17-19H,2-3,8-12H2,1H3,(H,24,25,26)/t15-,17-,18+/m0/s1 |
| InChIKey | SDPNICXFZPQEJG-RYQLBKOJSA-N |
| XLogP | 2.85 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|