C15H21F2N5O — CID 136891057
cyclopropyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136891057) has the molecular formula C15H21F2N5O and a molecular weight of 325.36 g/mol. Its IUPAC name is cyclopropyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136891057 |
| Molecular Formula | C15H21F2N5O |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | cyclopropyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC[C@@H]([C@@H]2C[C@H](C(F)F)n3ncnc3N2)C1 |
| InChI | InChI=1S/C15H21F2N5O/c16-13(17)12-6-11(20-15-18-8-19-22(12)15)10-2-1-5-21(7-10)14(23)9-3-4-9/h8-13H,1-7H2,(H,18,19,20)/t10-,11+,12-/m1/s1 |
| InChIKey | XHAAGFMNHUYPCX-GRYCIOLGSA-N |
| XLogP | 1.92 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |