C19H22F3N5O — CID 136761015
1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 136761015) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 136761015 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)C1 |
| InChI | InChI=1S/C19H22F3N5O/c20-14-6-2-1-4-12(14)8-17(28)26-7-3-5-13(10-26)15-9-16(18(21)22)27-19(25-15)23-11-24-27/h1-2,4,6,11,13,15-16,18H,3,5,7-10H2,(H,23,24,25)/t13?,15-,16+/m0/s1 |
| InChIKey | PKLQYRRELVLBLB-PXWJKWRZSA-N |
| XLogP | 2.89 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |