C17H20F3N5OS — CID 136760988
(5-methylthiophen-3-yl)-[3-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136760988) has the molecular formula C17H20F3N5OS and a molecular weight of 399.44 g/mol. Its IUPAC name is (5-methylthiophen-3-yl)-[3-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | (5-methylthiophen-3-yl)-[3-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136760988 |
| Molecular Formula | C17H20F3N5OS |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (5-methylthiophen-3-yl)-[3-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCC([C@@H]3C[C@H](C(F)(F)F)n4ncnc4N3)C2)cs1 |
| InChI | InChI=1S/C17H20F3N5OS/c1-10-5-12(8-27-10)15(26)24-4-2-3-11(7-24)13-6-14(17(18,19)20)25-16(23-13)21-9-22-25/h5,8-9,11,13-14H,2-4,6-7H2,1H3,(H,21,22,23)/t11?,13-,14+/m0/s1 |
| InChIKey | WCFRYWYNJKLYGU-SBKAZOPESA-N |
| XLogP | 3.49 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |