C20H28F2N4O3 — CID 136860572
(4S)-4-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]-5,5-dimethyloxolan-2-one (PubChem CID 136860572) has the molecular formula C20H28F2N4O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (4S)-4-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]-5,5-dimethyloxolan-2-one.
| Compound Name | (4S)-4-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]-5,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 136860572 |
| Molecular Formula | C20H28F2N4O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4S)-4-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]-5,5-dimethyloxolan-2-one |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H]([C@@H]1CCCN(C(=O)[C@H]3CC(=O)OC3(C)C)C1)N2 |
| InChI | InChI=1S/C20H28F2N4O3/c1-11-7-16-23-14(9-15(18(21)22)26(16)24-11)12-5-4-6-25(10-12)19(28)13-8-17(27)29-20(13,2)3/h7,12-15,18,23H,4-6,8-10H2,1-3H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | CTQOYUHIDPVQJF-APIJFGDWSA-N |
| XLogP | 2.76 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |