C19H23F2N5O — CID 136760822
[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 136760822) has the molecular formula C19H23F2N5O and a molecular weight of 375.42 g/mol. Its IUPAC name is [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 136760822 |
| Molecular Formula | C19H23F2N5O |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCCN(C(=O)c3ccccn3)C1)N2 |
| InChI | InChI=1S/C19H23F2N5O/c1-12-9-17-23-15(10-16(18(20)21)26(17)24-12)13-5-4-8-25(11-13)19(27)14-6-2-3-7-22-14/h2-3,6-7,9,13,15-16,18,23H,4-5,8,10-11H2,1H3/t13?,15-,16+/m0/s1 |
| InChIKey | RCAOZQYMPAGPKX-PXWJKWRZSA-N |
| XLogP | 3.13 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |