C24H32F2N4O2 — CID 136860949
(2R)-1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3,4-dimethylphenoxy)propan-1-one (PubChem CID 136860949) has the molecular formula C24H32F2N4O2 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R)-1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3,4-dimethylphenoxy)propan-1-one.
| Compound Name | (2R)-1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3,4-dimethylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 136860949 |
| Molecular Formula | C24H32F2N4O2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2R)-1-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(3,4-dimethylphenoxy)propan-1-one |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H]([C@@H]1CCCN(C(=O)[C@@H](C)Oc3ccc(C)c(C)c3)C1)N2 |
| InChI | InChI=1S/C24H32F2N4O2/c1-14-7-8-19(10-15(14)2)32-17(4)24(31)29-9-5-6-18(13-29)20-12-21(23(25)26)30-22(27-20)11-16(3)28-30/h7-8,10-11,17-18,20-21,23,27H,5-6,9,12-13H2,1-4H3/t17-,18-,20+,21-/m1/s1 |
| InChIKey | PEMQDTJGQKLLKZ-RMVXJAJNSA-N |
| XLogP | 4.50 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |