C22H30F2N4OS — CID 136760733
[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(5-methylthiophen-3-yl)methanone (PubChem CID 136760733) has the molecular formula C22H30F2N4OS and a molecular weight of 436.57 g/mol. Its IUPAC name is [4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(5-methylthiophen-3-yl)methanone.
| Compound Name | [4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(5-methylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 136760733 |
| Molecular Formula | C22H30F2N4OS |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(5-methylthiophen-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC([C@@H]3C[C@H](C(F)F)n4nc(C(C)(C)C)cc4N3)CC2)cs1 |
| InChI | InChI=1S/C22H30F2N4OS/c1-13-9-15(12-30-13)21(29)27-7-5-14(6-8-27)16-10-17(20(23)24)28-19(25-16)11-18(26-28)22(2,3)4/h9,11-12,14,16-17,20,25H,5-8,10H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | VYPDQGABFRRLMS-DLBZAZTESA-N |
| XLogP | 5.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |