C24H33F2N5O — CID 136760742
1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-3-pyridin-3-ylpropan-1-one (PubChem CID 136760742) has the molecular formula C24H33F2N5O and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 136760742 |
| Molecular Formula | C24H33F2N5O |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-3-pyridin-3-ylpropan-1-one |
| SMILES | CC(C)(C)c1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCN(C(=O)CCc3cccnc3)CC1)N2 |
| InChI | InChI=1S/C24H33F2N5O/c1-24(2,3)20-14-21-28-18(13-19(23(25)26)31(21)29-20)17-8-11-30(12-9-17)22(32)7-6-16-5-4-10-27-15-16/h4-5,10,14-15,17-19,23,28H,6-9,11-13H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | DVORSTAPMVKFRN-RBUKOAKNSA-N |
| XLogP | 4.44 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |