C23H34F2N4O — CID 136860241
1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(1R)-cyclopent-2-en-1-yl]ethanone (PubChem CID 136860241) has the molecular formula C23H34F2N4O and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(1R)-cyclopent-2-en-1-yl]ethanone.
| Compound Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(1R)-cyclopent-2-en-1-yl]ethanone |
|---|---|
| PubChem CID | 136860241 |
| Molecular Formula | C23H34F2N4O |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-[(1R)-cyclopent-2-en-1-yl]ethanone |
| SMILES | CC(C)(C)c1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCN(C(=O)C[C@@H]3C=CCC3)CC1)N2 |
| InChI | InChI=1S/C23H34F2N4O/c1-23(2,3)19-14-20-26-17(13-18(22(24)25)29(20)27-19)16-8-10-28(11-9-16)21(30)12-15-6-4-5-7-15/h4,6,14-18,22,26H,5,7-13H2,1-3H3/t15-,17+,18-/m1/s1 |
| InChIKey | ZFSATGVNDNULNB-BPQIPLTHSA-N |
| XLogP | 4.77 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|