C23H31F2N5O — CID 136763516
[(3S)-3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone (PubChem CID 136763516) has the molecular formula C23H31F2N5O and a molecular weight of 431.53 g/mol. Its IUPAC name is [(3S)-3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone.
| Compound Name | [(3S)-3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 136763516 |
| Molecular Formula | C23H31F2N5O |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | [(3S)-3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone |
| SMILES | Cc1cnccc1C(=O)N1CCC[C@H]([C@@H]2C[C@H](C(F)F)n3nc(C(C)(C)C)cc3N2)C1 |
| InChI | InChI=1S/C23H31F2N5O/c1-14-12-26-8-7-16(14)22(31)29-9-5-6-15(13-29)17-10-18(21(24)25)30-20(27-17)11-19(28-30)23(2,3)4/h7-8,11-12,15,17-18,21,27H,5-6,9-10,13H2,1-4H3/t15-,17-,18+/m0/s1 |
| InChIKey | JKDZLQJRAROOGA-RYQLBKOJSA-N |
| XLogP | 4.43 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |