C22H31F2N5O2 — CID 136760942
[3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone (PubChem CID 136760942) has the molecular formula C22H31F2N5O2 and a molecular weight of 435.52 g/mol. Its IUPAC name is [3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone.
| Compound Name | [3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 136760942 |
| Molecular Formula | C22H31F2N5O2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CCCC([C@@H]3C[C@H](C(F)F)n4nc(C(C)(C)C)cc4N3)C2)o1 |
| InChI | InChI=1S/C22H31F2N5O2/c1-12-19(31-13(2)25-12)21(30)28-8-6-7-14(11-28)15-9-16(20(23)24)29-18(26-15)10-17(27-29)22(3,4)5/h10,14-16,20,26H,6-9,11H2,1-5H3/t14?,15-,16+/m0/s1 |
| InChIKey | YGIFVRBWIMIHKT-MERJSTESSA-N |
| XLogP | 4.33 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |