C22H37F2N5O — CID 136760946
1-[3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(diethylamino)ethanone (PubChem CID 136760946) has the molecular formula C22H37F2N5O and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(diethylamino)ethanone.
| Compound Name | 1-[3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(diethylamino)ethanone |
|---|---|
| PubChem CID | 136760946 |
| Molecular Formula | C22H37F2N5O |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 1-[3-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-(diethylamino)ethanone |
| SMILES | CCN(CC)CC(=O)N1CCCC([C@@H]2C[C@H](C(F)F)n3nc(C(C)(C)C)cc3N2)C1 |
| InChI | InChI=1S/C22H37F2N5O/c1-6-27(7-2)14-20(30)28-10-8-9-15(13-28)16-11-17(21(23)24)29-19(25-16)12-18(26-29)22(3,4)5/h12,15-17,21,25H,6-11,13-14H2,1-5H3/t15?,16-,17+/m0/s1 |
| InChIKey | RWIPENMVMNPKEB-LRUHZDSUSA-N |
| XLogP | 3.75 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |