C19H22F3N5O — CID 136761355
[3-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 136761355) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is [3-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [3-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 136761355 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [3-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | C[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCCN(C(=O)c4ccncc4)C3)cc2N1 |
| InChI | InChI=1S/C19H22F3N5O/c1-12-9-16(19(20,21)22)27-17(24-12)10-15(25-27)14-3-2-8-26(11-14)18(28)13-4-6-23-7-5-13/h4-7,10,12,14,16,24H,2-3,8-9,11H2,1H3/t12-,14?,16-/m1/s1 |
| InChIKey | GNURNVLGQVZIDR-QXDOLYAVSA-N |
| XLogP | 3.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |