C17H21F3N6OS — CID 136761313
(4-methylthiadiazol-5-yl)-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone (PubChem CID 136761313) has the molecular formula C17H21F3N6OS and a molecular weight of 414.46 g/mol. Its IUPAC name is (4-methylthiadiazol-5-yl)-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | (4-methylthiadiazol-5-yl)-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136761313 |
| Molecular Formula | C17H21F3N6OS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (4-methylthiadiazol-5-yl)-[4-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone |
| SMILES | Cc1nnsc1C(=O)N1CCC(c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C)N3)CC1 |
| InChI | InChI=1S/C17H21F3N6OS/c1-9-7-13(17(18,19)20)26-14(21-9)8-12(23-26)11-3-5-25(6-4-11)16(27)15-10(2)22-24-28-15/h8-9,11,13,21H,3-7H2,1-2H3/t9-,13-/m1/s1 |
| InChIKey | NNPCIJTVLWVJJD-NOZJJQNGSA-N |
| XLogP | 3.37 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |