C18H23F3N6OS — CID 136761169
[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 136761169) has the molecular formula C18H23F3N6OS and a molecular weight of 428.48 g/mol. Its IUPAC name is [2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 136761169 |
| Molecular Formula | C18H23F3N6OS |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCCCN3C(=O)c3snnc3C)cc2N1 |
| InChI | InChI=1S/C18H23F3N6OS/c1-3-11-8-14(18(19,20)21)27-15(22-11)9-12(24-27)13-6-4-5-7-26(13)17(28)16-10(2)23-25-29-16/h9,11,13-14,22H,3-8H2,1-2H3/t11-,13?,14-/m1/s1 |
| InChIKey | PHUKQRGHNVJERW-AODWJNRKSA-N |
| XLogP | 4.11 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |