C19H27F3N4O2 — CID 136892514
1-[(2R)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone (PubChem CID 136892514) has the molecular formula C19H27F3N4O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[(2R)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone.
| Compound Name | 1-[(2R)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 136892514 |
| Molecular Formula | C19H27F3N4O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[(2R)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc([C@H]3CCCN3C(=O)C[C@@H]3CCCO3)cc2N1 |
| InChI | InChI=1S/C19H27F3N4O2/c1-2-12-9-16(19(20,21)22)26-17(23-12)11-14(24-26)15-6-3-7-25(15)18(27)10-13-5-4-8-28-13/h11-13,15-16,23H,2-10H2,1H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | FNNJDGBOTUYWOF-OCVGTWLNSA-N |
| XLogP | 3.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |