C19H25F3N6O — CID 136734871
(1,3-dimethylpyrazol-4-yl)-[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 136734871) has the molecular formula C19H25F3N6O and a molecular weight of 410.44 g/mol. Its IUPAC name is (1,3-dimethylpyrazol-4-yl)-[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (1,3-dimethylpyrazol-4-yl)-[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 136734871 |
| Molecular Formula | C19H25F3N6O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (1,3-dimethylpyrazol-4-yl)-[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc([C@@H]3CCCN3C(=O)c3cn(C)nc3C)cc2N1 |
| InChI | InChI=1S/C19H25F3N6O/c1-4-12-8-16(19(20,21)22)28-17(23-12)9-14(25-28)15-6-5-7-27(15)18(29)13-10-26(3)24-11(13)2/h9-10,12,15-16,23H,4-8H2,1-3H3/t12-,15+,16-/m1/s1 |
| InChIKey | OKUVLHNYYBJKSM-UHOFOFEASA-N |
| XLogP | 3.60 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |