C21H26F3N5O — CID 136892469
[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone (PubChem CID 136892469) has the molecular formula C21H26F3N5O and a molecular weight of 421.47 g/mol. Its IUPAC name is [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone.
| Compound Name | [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 136892469 |
| Molecular Formula | C21H26F3N5O |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-(3-methyl-4-pyridinyl)methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc([C@@H]3CCCCN3C(=O)c3ccncc3C)cc2N1 |
| InChI | InChI=1S/C21H26F3N5O/c1-3-14-10-18(21(22,23)24)29-19(26-14)11-16(27-29)17-6-4-5-9-28(17)20(30)15-7-8-25-12-13(15)2/h7-8,11-12,14,17-18,26H,3-6,9-10H2,1-2H3/t14-,17+,18-/m1/s1 |
| InChIKey | NWZVDUYUOMBPCI-FHLIZLRMSA-N |
| XLogP | 4.65 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |