C17H23F3N4O — CID 136760487
cyclopropyl-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 136760487) has the molecular formula C17H23F3N4O and a molecular weight of 356.39 g/mol. Its IUPAC name is cyclopropyl-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 136760487 |
| Molecular Formula | C17H23F3N4O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | cyclopropyl-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCCN3C(=O)C3CC3)cc2N1 |
| InChI | InChI=1S/C17H23F3N4O/c1-2-11-8-14(17(18,19)20)24-15(21-11)9-12(22-24)13-4-3-7-23(13)16(25)10-5-6-10/h9-11,13-14,21H,2-8H2,1H3/t11-,13?,14-/m1/s1 |
| InChIKey | ZSOFVKKYHMBART-AODWJNRKSA-N |
| XLogP | 3.65 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |