C19H23F3N6O — CID 136734873
[(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 136734873) has the molecular formula C19H23F3N6O and a molecular weight of 408.43 g/mol. Its IUPAC name is [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 136734873 |
| Molecular Formula | C19H23F3N6O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [(2S)-2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc([C@@H]3CCCN3C(=O)c3cnc(C)cn3)cc2N1 |
| InChI | InChI=1S/C19H23F3N6O/c1-3-12-7-16(19(20,21)22)28-17(25-12)8-13(26-28)15-5-4-6-27(15)18(29)14-10-23-11(2)9-24-14/h8-10,12,15-16,25H,3-7H2,1-2H3/t12-,15+,16-/m1/s1 |
| InChIKey | XDDPZBJUGQQHLS-UHOFOFEASA-N |
| XLogP | 3.66 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |