C21H28F3N5 — CID 136892136
(5R,7S)-5-ethyl-2-[(3R)-1-[(3-methyl-4-pyridinyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136892136) has the molecular formula C21H28F3N5 and a molecular weight of 407.48 g/mol. Its IUPAC name is (5R,7S)-5-ethyl-2-[(3R)-1-[(3-methyl-4-pyridinyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-5-ethyl-2-[(3R)-1-[(3-methyl-4-pyridinyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136892136 |
| Molecular Formula | C21H28F3N5 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (5R,7S)-5-ethyl-2-[(3R)-1-[(3-methyl-4-pyridinyl)methyl]piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | CC[C@@H]1C[C@@H](C(F)(F)F)n2nc([C@@H]3CCCN(Cc4ccncc4C)C3)cc2N1 |
| InChI | InChI=1S/C21H28F3N5/c1-3-17-9-19(21(22,23)24)29-20(26-17)10-18(27-29)16-5-4-8-28(13-16)12-15-6-7-25-11-14(15)2/h6-7,10-11,16-17,19,26H,3-5,8-9,12-13H2,1-2H3/t16-,17-,19+/m1/s1 |
| InChIKey | RWCYJNURQPBREZ-LMMKCTJWSA-N |
| XLogP | 4.66 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |