C22H28F3N5O — CID 136761249
[4-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 136761249) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is [4-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 136761249 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [4-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | CC(C)(C)[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCN(C(=O)c4ccccn4)CC3)cc2N1 |
| InChI | InChI=1S/C22H28F3N5O/c1-21(2,3)17-13-18(22(23,24)25)30-19(27-17)12-16(28-30)14-7-10-29(11-8-14)20(31)15-6-4-5-9-26-15/h4-6,9,12,14,17-18,27H,7-8,10-11,13H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | KJTSMFKMBJRNPM-ZWKOTPCHSA-N |
| XLogP | 4.63 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |