C12H15F3N3O2- — CID 135764520
(5R,7S)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 135764520) has the molecular formula C12H15F3N3O2- and a molecular weight of 290.26 g/mol. Its IUPAC name is (5R,7S)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (5R,7S)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 135764520 |
| Molecular Formula | C12H15F3N3O2- |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (5R,7S)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CC(C)(C)[C@H]1C[C@@H](C(F)(F)F)n2nc(C(=O)[O-])cc2N1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-11(2,3)7-5-8(12(13,14)15)18-9(16-7)4-6(17-18)10(19)20/h4,7-8,16H,5H2,1-3H3,(H,19,20)/p-1/t7-,8+/m1/s1 |
| InChIKey | YKJBBJYORBOEOO-SFYZADRCSA-M |
| XLogP | 1.58 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |