C21H31F3N4O2 — CID 136860155
[(2R)-2-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 136860155) has the molecular formula C21H31F3N4O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is [(2R)-2-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [(2R)-2-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 136860155 |
| Molecular Formula | C21H31F3N4O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [(2R)-2-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | CC(C)(C)[C@@H]1C[C@H](C(F)(F)F)n2nc([C@H]3CCCCN3C(=O)[C@@H]3CCCO3)cc2N1 |
| InChI | InChI=1S/C21H31F3N4O2/c1-20(2,3)16-12-17(21(22,23)24)28-18(25-16)11-13(26-28)14-7-4-5-9-27(14)19(29)15-8-6-10-30-15/h11,14-17,25H,4-10,12H2,1-3H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | GQRBACUTVIGEAX-LTIDMASMSA-N |
| XLogP | 4.45 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |