C21H31F3N6 — CID 136761120
(5S,7R)-5-tert-butyl-2-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136761120) has the molecular formula C21H31F3N6 and a molecular weight of 424.52 g/mol. Its IUPAC name is (5S,7R)-5-tert-butyl-2-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-5-tert-butyl-2-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136761120 |
| Molecular Formula | C21H31F3N6 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (5S,7R)-5-tert-butyl-2-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | Cn1cc(CN2CCCCC2c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C(C)(C)C)N3)cn1 |
| InChI | InChI=1S/C21H31F3N6/c1-20(2,3)17-10-18(21(22,23)24)30-19(26-17)9-15(27-30)16-7-5-6-8-29(16)13-14-11-25-28(4)12-14/h9,11-12,16-18,26H,5-8,10,13H2,1-4H3/t16?,17-,18+/m0/s1 |
| InChIKey | GLIYEULSAYDNTI-UQJFVLDMSA-N |
| XLogP | 4.68 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |