C21H27F3N4O2 — CID 136850953
[2-methoxy-5-[[(2S)-2-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methyl]phenyl]methanol (PubChem CID 136850953) has the molecular formula C21H27F3N4O2 and a molecular weight of 424.47 g/mol. Its IUPAC name is [2-methoxy-5-[[(2S)-2-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methyl]phenyl]methanol.
| Compound Name | [2-methoxy-5-[[(2S)-2-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 136850953 |
| Molecular Formula | C21H27F3N4O2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [2-methoxy-5-[[(2S)-2-[(5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methyl]phenyl]methanol |
| SMILES | COc1ccc(CN2CCC[C@H]2c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C)N3)cc1CO |
| InChI | InChI=1S/C21H27F3N4O2/c1-13-8-19(21(22,23)24)28-20(25-13)10-16(26-28)17-4-3-7-27(17)11-14-5-6-18(30-2)15(9-14)12-29/h5-6,9-10,13,17,19,25,29H,3-4,7-8,11-12H2,1-2H3/t13-,17+,19-/m1/s1 |
| InChIKey | NKNFNIKJSBTVBC-XVGQJIODSA-N |
| XLogP | 4.03 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |