C22H30F3N5 — CID 136860172
(5S,7R)-5-tert-butyl-2-[(2S)-1-(pyridin-3-ylmethyl)piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136860172) has the molecular formula C22H30F3N5 and a molecular weight of 421.51 g/mol. Its IUPAC name is (5S,7R)-5-tert-butyl-2-[(2S)-1-(pyridin-3-ylmethyl)piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-5-tert-butyl-2-[(2S)-1-(pyridin-3-ylmethyl)piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136860172 |
| Molecular Formula | C22H30F3N5 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (5S,7R)-5-tert-butyl-2-[(2S)-1-(pyridin-3-ylmethyl)piperidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | CC(C)(C)[C@@H]1C[C@H](C(F)(F)F)n2nc([C@@H]3CCCCN3Cc3cccnc3)cc2N1 |
| InChI | InChI=1S/C22H30F3N5/c1-21(2,3)18-12-19(22(23,24)25)30-20(27-18)11-16(28-30)17-8-4-5-10-29(17)14-15-7-6-9-26-13-15/h6-7,9,11,13,17-19,27H,4-5,8,10,12,14H2,1-3H3/t17-,18-,19+/m0/s1 |
| InChIKey | VCRMFRYYASZRSD-GBESFXJTSA-N |
| XLogP | 5.34 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |