C21H27F3N4O2 — CID 136850960
(5R,7R)-2-[(2R)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-yl]-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136850960) has the molecular formula C21H27F3N4O2 and a molecular weight of 424.47 g/mol. Its IUPAC name is (5R,7R)-2-[(2R)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-yl]-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7R)-2-[(2R)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-yl]-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136850960 |
| Molecular Formula | C21H27F3N4O2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (5R,7R)-2-[(2R)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-yl]-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc(CN2CCC[C@@H]2c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C)N3)c(OC)c1 |
| InChI | InChI=1S/C21H27F3N4O2/c1-13-9-19(21(22,23)24)28-20(25-13)11-16(26-28)17-5-4-8-27(17)12-14-6-7-15(29-2)10-18(14)30-3/h6-7,10-11,13,17,19,25H,4-5,8-9,12H2,1-3H3/t13-,17-,19-/m1/s1 |
| InChIKey | LVDGQRRNSJYEMK-OMWUSAIZSA-N |
| XLogP | 4.54 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |