C20H29F3N4O2 — CID 136891340
[(2S)-oxolan-2-yl]-[(2R)-2-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone (PubChem CID 136891340) has the molecular formula C20H29F3N4O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]-[(2R)-2-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | [(2S)-oxolan-2-yl]-[(2R)-2-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136891340 |
| Molecular Formula | C20H29F3N4O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [(2S)-oxolan-2-yl]-[(2R)-2-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]piperidin-1-yl]methanone |
| SMILES | CC(C)[C@@H]1C[C@H](C(F)(F)F)n2nc([C@H]3CCCCN3C(=O)[C@@H]3CCCO3)cc2N1 |
| InChI | InChI=1S/C20H29F3N4O2/c1-12(2)13-10-17(20(21,22)23)27-18(24-13)11-14(25-27)15-6-3-4-8-26(15)19(28)16-7-5-9-29-16/h11-13,15-17,24H,3-10H2,1-2H3/t13-,15+,16-,17+/m0/s1 |
| InChIKey | BVQWDMDGEUPKNX-PQEBFOHHSA-N |
| XLogP | 4.06 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |