C16H25F3N4O2S — CID 136761140
(5S,7R)-2-(1-methylsulfonylpiperidin-2-yl)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136761140) has the molecular formula C16H25F3N4O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is (5S,7R)-2-(1-methylsulfonylpiperidin-2-yl)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-2-(1-methylsulfonylpiperidin-2-yl)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136761140 |
| Molecular Formula | C16H25F3N4O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (5S,7R)-2-(1-methylsulfonylpiperidin-2-yl)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | CC(C)[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCCCN3S(C)(=O)=O)cc2N1 |
| InChI | InChI=1S/C16H25F3N4O2S/c1-10(2)11-8-14(16(17,18)19)23-15(20-11)9-12(21-23)13-6-4-5-7-22(13)26(3,24)25/h9-11,13-14,20H,4-8H2,1-3H3/t11-,13?,14+/m0/s1 |
| InChIKey | VGNAWJDUFCWWGC-JDZGAICCSA-N |
| XLogP | 3.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |