C19H22F4N4O2S — CID 136892144
(5R,7S)-5-ethyl-2-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136892144) has the molecular formula C19H22F4N4O2S and a molecular weight of 446.47 g/mol. Its IUPAC name is (5R,7S)-5-ethyl-2-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-5-ethyl-2-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136892144 |
| Molecular Formula | C19H22F4N4O2S |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (5R,7S)-5-ethyl-2-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine |
| SMILES | CC[C@@H]1C[C@@H](C(F)(F)F)n2nc([C@@H]3CCCN3S(=O)(=O)c3ccc(F)cc3)cc2N1 |
| InChI | InChI=1S/C19H22F4N4O2S/c1-2-13-10-17(19(21,22)23)27-18(24-13)11-15(25-27)16-4-3-9-26(16)30(28,29)14-7-5-12(20)6-8-14/h5-8,11,13,16-17,24H,2-4,9-10H2,1H3/t13-,16+,17+/m1/s1 |
| InChIKey | JCUAJCIUJJBTIN-COXVUDFISA-N |
| XLogP | 4.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |