C18H24N4O4S — CID 136761470
4-ethyl-2-[[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]-1H-pyrimidin-6-one (PubChem CID 136761470) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-ethyl-2-[[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136761470 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-ethyl-2-[[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(NC2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C18H24N4O4S/c1-3-13-12-17(23)21-18(19-13)20-14-8-10-22(11-9-14)27(24,25)16-6-4-15(26-2)5-7-16/h4-7,12,14H,3,8-11H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | XKORDQMNHUBDHF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |