C15H17N3O2 — CID 136762066
N-(4-hydroxy-2,5-dimethylphenyl)-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 136762066) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(4-hydroxy-2,5-dimethylphenyl)-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-(4-hydroxy-2,5-dimethylphenyl)-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 136762066 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-(4-hydroxy-2,5-dimethylphenyl)-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C)c(O)cc2C)c(C)nn1 |
| InChI | InChI=1S/C15H17N3O2/c1-8-6-14(19)9(2)5-13(8)16-15(20)12-7-10(3)17-18-11(12)4/h5-7,19H,1-4H3,(H,16,20) |
| InChIKey | HTZDAGPZDATHTL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|