C31H35NO5 — CID 1367622
[(2R)-oxolan-2-yl]methyl (4S)-2,7,7-trimethyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 1367622) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (4S)-2,7,7-trimethyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (4S)-2,7,7-trimethyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 1367622 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (4S)-2,7,7-trimethyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC[C@H]2CCCO2)[C@@H](c2cccc(OCc3ccccc3)c2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C31H35NO5/c1-20-27(30(34)37-19-24-13-8-14-35-24)28(29-25(32-20)16-31(2,3)17-26(29)33)22-11-7-12-23(15-22)36-18-21-9-5-4-6-10-21/h4-7,9-12,15,24,28,32H,8,13-14,16-19H2,1-3H3/t24-,28-/m1/s1 |
| InChIKey | UTCUJNYURCINBS-UFHPHHKVSA-N |
| XLogP | 5.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |