C27H35NO5 — CID 2966330
oxolan-2-ylmethyl 2,7,7-trimethyl-5-oxo-4-(4-propan-2-yloxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2966330) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2,7,7-trimethyl-5-oxo-4-(4-propan-2-yloxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | oxolan-2-ylmethyl 2,7,7-trimethyl-5-oxo-4-(4-propan-2-yloxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2966330 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | oxolan-2-ylmethyl 2,7,7-trimethyl-5-oxo-4-(4-propan-2-yloxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OCC2CCCO2)C(c2ccc(OC(C)C)cc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C27H35NO5/c1-16(2)33-19-10-8-18(9-11-19)24-23(26(30)32-15-20-7-6-12-31-20)17(3)28-21-13-27(4,5)14-22(29)25(21)24/h8-11,16,20,24,28H,6-7,12-15H2,1-5H3 |
| InChIKey | BVUQBVLLXBQCOE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |