C23H26N4O3 — CID 136763372
(1R,10S)-5-methyl-13-[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136763372) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (1R,10S)-5-methyl-13-[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1R,10S)-5-methyl-13-[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136763372 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (1R,10S)-5-methyl-13-[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@@H]1CC[C@H](C2)N1C(=O)[C@H]1CC(=O)N(c2ccccc2C)C1 |
| InChI | InChI=1S/C23H26N4O3/c1-13-5-3-4-6-20(13)26-12-15(9-21(26)28)23(30)27-16-7-8-17(27)11-19-18(10-16)22(29)25-14(2)24-19/h3-6,15-17H,7-12H2,1-2H3,(H,24,25,29)/t15-,16-,17+/m0/s1 |
| InChIKey | HCOSGQDVFSZHCB-YESZJQIVSA-N |
| XLogP | 1.90 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |