C24H30N4O2S — CID 136763428
2-[(2R)-1-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]pyrrolidin-2-yl]-6-[(3-methylthiophen-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136763428) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-[(2R)-1-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]pyrrolidin-2-yl]-6-[(3-methylthiophen-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[(2R)-1-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]pyrrolidin-2-yl]-6-[(3-methylthiophen-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136763428 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-[(2R)-1-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]pyrrolidin-2-yl]-6-[(3-methylthiophen-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccsc1CN1CCc2nc([C@H]3CCCN3C(=O)C[C@H]3C=CCC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C24H30N4O2S/c1-16-9-12-31-21(16)15-27-11-8-19-18(14-27)24(30)26-23(25-19)20-7-4-10-28(20)22(29)13-17-5-2-3-6-17/h2,5,9,12,17,20H,3-4,6-8,10-11,13-15H2,1H3,(H,25,26,30)/t17-,20+/m0/s1 |
| InChIKey | PMNWPCUMKYGKHY-FXAWDEMLSA-N |
| XLogP | 3.72 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|